C10H14BrN5O — CID 62400109
2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-tert-butyl-1,3,4-oxadiazole (PubChem CID 62400109) has the molecular formula C10H14BrN5O and a molecular weight of 300.16 g/mol. Its IUPAC name is 2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-tert-butyl-1,3,4-oxadiazole.
| Compound Name | 2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-tert-butyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 62400109 |
| Molecular Formula | C10H14BrN5O |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-tert-butyl-1,3,4-oxadiazole |
| SMILES | CC(C)(C)c1nnc(Cn2cc(CBr)nn2)o1 |
| InChI | InChI=1S/C10H14BrN5O/c1-10(2,3)9-14-13-8(17-9)6-16-5-7(4-11)12-15-16/h5H,4,6H2,1-3H3 |
| InChIKey | PDSTXVBUFJHCOJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|