C11H16ClN5O — CID 81450000
2-tert-butyl-5-[[4-(1-chloroethyl)triazol-1-yl]methyl]-1,3,4-oxadiazole (PubChem CID 81450000) has the molecular formula C11H16ClN5O and a molecular weight of 269.74 g/mol. Its IUPAC name is 2-tert-butyl-5-[[4-(1-chloroethyl)triazol-1-yl]methyl]-1,3,4-oxadiazole.
| Compound Name | 2-tert-butyl-5-[[4-(1-chloroethyl)triazol-1-yl]methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 81450000 |
| Molecular Formula | C11H16ClN5O |
| Molecular Weight | 269.74 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2-tert-butyl-5-[[4-(1-chloroethyl)triazol-1-yl]methyl]-1,3,4-oxadiazole |
| SMILES | CC(Cl)c1cn(Cc2nnc(C(C)(C)C)o2)nn1 |
| InChI | InChI=1S/C11H16ClN5O/c1-7(12)8-5-17(16-13-8)6-9-14-15-10(18-9)11(2,3)4/h5,7H,6H2,1-4H3 |
| InChIKey | NUELJWPUZWMOGH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.74 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|