C11H14N4O4S — CID 62402229
4-[2-[4-(hydroxymethyl)triazol-1-yl]ethoxy]benzenesulfonamide (PubChem CID 62402229) has the molecular formula C11H14N4O4S and a molecular weight of 298.32 g/mol. Its IUPAC name is 4-[2-[4-(hydroxymethyl)triazol-1-yl]ethoxy]benzenesulfonamide.
| Compound Name | 4-[2-[4-(hydroxymethyl)triazol-1-yl]ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 62402229 |
| Molecular Formula | C11H14N4O4S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 4-[2-[4-(hydroxymethyl)triazol-1-yl]ethoxy]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(OCCn2cc(CO)nn2)cc1 |
| InChI | InChI=1S/C11H14N4O4S/c12-20(17,18)11-3-1-10(2-4-11)19-6-5-15-7-9(8-16)13-14-15/h1-4,7,16H,5-6,8H2,(H2,12,17,18) |
| InChIKey | GGGSZKVDIOCBTD-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |