C16H29N3 — CID 62430423
N'-ethyl-N-propyl-N'-(pyridin-4-ylmethyl)pentane-1,5-diamine (PubChem CID 62430423) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is N'-ethyl-N-propyl-N'-(pyridin-4-ylmethyl)pentane-1,5-diamine.
| Compound Name | N'-ethyl-N-propyl-N'-(pyridin-4-ylmethyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 62430423 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | N'-ethyl-N-propyl-N'-(pyridin-4-ylmethyl)pentane-1,5-diamine |
| SMILES | CCCNCCCCCN(CC)Cc1ccncc1 |
| InChI | InChI=1S/C16H29N3/c1-3-10-17-11-6-5-7-14-19(4-2)15-16-8-12-18-13-9-16/h8-9,12-13,17H,3-7,10-11,14-15H2,1-2H3 |
| InChIKey | NZSULJAVJCIBMB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|