C14H32N2 — CID 62433937
3-N-methyl-3-N-(3-methylbutan-2-yl)-1-N-(2-methylpropyl)butane-1,3-diamine (PubChem CID 62433937) has the molecular formula C14H32N2 and a molecular weight of 228.42 g/mol. Its IUPAC name is 3-N-methyl-3-N-(3-methylbutan-2-yl)-1-N-(2-methylpropyl)butane-1,3-diamine.
| Compound Name | 3-N-methyl-3-N-(3-methylbutan-2-yl)-1-N-(2-methylpropyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 62433937 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | 3-N-methyl-3-N-(3-methylbutan-2-yl)-1-N-(2-methylpropyl)butane-1,3-diamine |
| SMILES | CC(C)CNCCC(C)N(C)C(C)C(C)C |
| InChI | InChI=1S/C14H32N2/c1-11(2)10-15-9-8-13(5)16(7)14(6)12(3)4/h11-15H,8-10H2,1-7H3 |
| InChIKey | RTKYFLHWZNNKPL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|