C14H26N2O3 — CID 62447453
N-[[5-(aminomethyl)-4-methylfuran-2-yl]methyl]-1-methoxy-N-(2-methoxyethyl)propan-2-amine (PubChem CID 62447453) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is N-[[5-(aminomethyl)-4-methylfuran-2-yl]methyl]-1-methoxy-N-(2-methoxyethyl)propan-2-amine.
| Compound Name | N-[[5-(aminomethyl)-4-methylfuran-2-yl]methyl]-1-methoxy-N-(2-methoxyethyl)propan-2-amine |
|---|---|
| PubChem CID | 62447453 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | N-[[5-(aminomethyl)-4-methylfuran-2-yl]methyl]-1-methoxy-N-(2-methoxyethyl)propan-2-amine |
| SMILES | COCCN(Cc1cc(C)c(CN)o1)C(C)COC |
| InChI | InChI=1S/C14H26N2O3/c1-11-7-13(19-14(11)8-15)9-16(5-6-17-3)12(2)10-18-4/h7,12H,5-6,8-10,15H2,1-4H3 |
| InChIKey | IQIXWCMNRZUYLC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 60.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |