C20H21N3O3 — CID 6246081
N-[(Z)-[(E)-4-(1,3-benzodioxol-5-yl)but-3-en-2-ylidene]amino]-2-(4-methylanilino)acetamide (PubChem CID 6246081) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[(Z)-[(E)-4-(1,3-benzodioxol-5-yl)but-3-en-2-ylidene]amino]-2-(4-methylanilino)acetamide.
| Compound Name | N-[(Z)-[(E)-4-(1,3-benzodioxol-5-yl)but-3-en-2-ylidene]amino]-2-(4-methylanilino)acetamide |
|---|---|
| PubChem CID | 6246081 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-[(Z)-[(E)-4-(1,3-benzodioxol-5-yl)but-3-en-2-ylidene]amino]-2-(4-methylanilino)acetamide |
| SMILES | CC(/C=C/c1ccc2c(c1)OCO2)=N/NC(=O)CNc1ccc(C)cc1 |
| InChI | InChI=1S/C20H21N3O3/c1-14-3-8-17(9-4-14)21-12-20(24)23-22-15(2)5-6-16-7-10-18-19(11-16)26-13-25-18/h3-11,21H,12-13H2,1-2H3,(H,23,24)/b6-5+,22-15- |
| InChIKey | RFUTWHVNYCNGFH-OGFBTTSKSA-N |
| XLogP | 3.34 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|