C13H11N5O — CID 62466522
3-[(2-amino-4-pyridinyl)methyl]-1,2,3-benzotriazin-4-one (PubChem CID 62466522) has the molecular formula C13H11N5O and a molecular weight of 253.27 g/mol. Its IUPAC name is 3-[(2-amino-4-pyridinyl)methyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[(2-amino-4-pyridinyl)methyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 62466522 |
| Molecular Formula | C13H11N5O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 3-[(2-amino-4-pyridinyl)methyl]-1,2,3-benzotriazin-4-one |
| SMILES | Nc1cc(Cn2nnc3ccccc3c2=O)ccn1 |
| InChI | InChI=1S/C13H11N5O/c14-12-7-9(5-6-15-12)8-18-13(19)10-3-1-2-4-11(10)16-17-18/h1-7H,8H2,(H2,14,15) |
| InChIKey | GKYAWJXVVCAOGX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |