C12H15N3O — CID 62482242
N-[4-(furan-2-yl)butan-2-yl]pyridazin-3-amine (PubChem CID 62482242) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is N-[4-(furan-2-yl)butan-2-yl]pyridazin-3-amine.
| Compound Name | N-[4-(furan-2-yl)butan-2-yl]pyridazin-3-amine |
|---|---|
| PubChem CID | 62482242 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | N-[4-(furan-2-yl)butan-2-yl]pyridazin-3-amine |
| SMILES | CC(CCc1ccco1)Nc1cccnn1 |
| InChI | InChI=1S/C12H15N3O/c1-10(6-7-11-4-3-9-16-11)14-12-5-2-8-13-15-12/h2-5,8-10H,6-7H2,1H3,(H,14,15) |
| InChIKey | CKVFJBPFWROIRQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |