C13H15N3O3 — CID 66449084
6-[4-(furan-2-yl)butan-2-ylamino]pyrazine-2-carboxylic acid (PubChem CID 66449084) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 6-[4-(furan-2-yl)butan-2-ylamino]pyrazine-2-carboxylic acid.
| Compound Name | 6-[4-(furan-2-yl)butan-2-ylamino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 66449084 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 6-[4-(furan-2-yl)butan-2-ylamino]pyrazine-2-carboxylic acid |
| SMILES | CC(CCc1ccco1)Nc1cncc(C(=O)O)n1 |
| InChI | InChI=1S/C13H15N3O3/c1-9(4-5-10-3-2-6-19-10)15-12-8-14-7-11(16-12)13(17)18/h2-3,6-9H,4-5H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | FRXOUKGGWPZYAY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |