C12H14N2O3S — CID 80571184
2-[4-(furan-2-yl)butan-2-ylamino]-1,3-thiazole-5-carboxylic acid (PubChem CID 80571184) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)butan-2-ylamino]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[4-(furan-2-yl)butan-2-ylamino]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 80571184 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-[4-(furan-2-yl)butan-2-ylamino]-1,3-thiazole-5-carboxylic acid |
| SMILES | CC(CCc1ccco1)Nc1ncc(C(=O)O)s1 |
| InChI | InChI=1S/C12H14N2O3S/c1-8(4-5-9-3-2-6-17-9)14-12-13-7-10(18-12)11(15)16/h2-3,6-8H,4-5H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | COZIMLRZBUJLQR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |