C14H23NO3 — CID 62486908
N-[[5-(oxan-4-ylmethoxymethyl)furan-2-yl]methyl]ethanamine (PubChem CID 62486908) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is N-[[5-(oxan-4-ylmethoxymethyl)furan-2-yl]methyl]ethanamine.
| Compound Name | N-[[5-(oxan-4-ylmethoxymethyl)furan-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 62486908 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | N-[[5-(oxan-4-ylmethoxymethyl)furan-2-yl]methyl]ethanamine |
| SMILES | CCNCc1ccc(COCC2CCOCC2)o1 |
| InChI | InChI=1S/C14H23NO3/c1-2-15-9-13-3-4-14(18-13)11-17-10-12-5-7-16-8-6-12/h3-4,12,15H,2,5-11H2,1H3 |
| InChIKey | JFXGUHSBZIARJI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |