C23H26ClN3S — CID 624989
2-(4-chlorophenyl)-N-[3-(4-methylpiperazin-1-yl)propyl]thiochromen-4-imine (PubChem CID 624989) has the molecular formula C23H26ClN3S and a molecular weight of 412.00 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[3-(4-methylpiperazin-1-yl)propyl]thiochromen-4-imine.
| Compound Name | 2-(4-chlorophenyl)-N-[3-(4-methylpiperazin-1-yl)propyl]thiochromen-4-imine |
|---|---|
| PubChem CID | 624989 |
| Molecular Formula | C23H26ClN3S |
| Molecular Weight | 412.00 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[3-(4-methylpiperazin-1-yl)propyl]thiochromen-4-imine |
| SMILES | CN1CCN(CCC/N=c2\cc(-c3ccc(Cl)cc3)sc3ccccc23)CC1 |
| InChI | InChI=1S/C23H26ClN3S/c1-26-13-15-27(16-14-26)12-4-11-25-21-17-23(18-7-9-19(24)10-8-18)28-22-6-3-2-5-20(21)22/h2-3,5-10,17H,4,11-16H2,1H3/b25-21+ |
| InChIKey | JIYDDMSIFWBMPH-NJNXFGOHSA-N |
| XLogP | 4.76 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.00 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|