C20H24Cl2N2OS — CID 90673539
3-[(6-chloro-2-phenylthiochromen-4-ylidene)amino]-N,N-dimethylpropan-1-amine;hydrate;hydrochloride (PubChem CID 90673539) has the molecular formula C20H24Cl2N2OS and a molecular weight of 411.40 g/mol. Its IUPAC name is 3-[(6-chloro-2-phenylthiochromen-4-ylidene)amino]-N,N-dimethylpropan-1-amine;hydrate;hydrochloride.
| Compound Name | 3-[(6-chloro-2-phenylthiochromen-4-ylidene)amino]-N,N-dimethylpropan-1-amine;hydrate;hydrochloride |
|---|---|
| PubChem CID | 90673539 |
| Molecular Formula | C20H24Cl2N2OS |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 3-[(6-chloro-2-phenylthiochromen-4-ylidene)amino]-N,N-dimethylpropan-1-amine;hydrate;hydrochloride |
| SMILES | CN(C)CCC/N=c1\cc(-c2ccccc2)sc2ccc(Cl)cc12.Cl.O |
| InChI | InChI=1S/C20H21ClN2S.ClH.H2O/c1-23(2)12-6-11-22-18-14-20(15-7-4-3-5-8-15)24-19-10-9-16(21)13-17(18)19;;/h3-5,7-10,13-14H,6,11-12H2,1-2H3;1H;1H2/b22-18+;; |
| InChIKey | UNWVKLIGFQFCIL-OIWVIQBMSA-N |
| XLogP | 4.67 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|