About cycloheptyl 2-(3-aminophenyl)acetate
cycloheptyl 2-(3-aminophenyl)acetate (PubChem CID 62499374) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is cycloheptyl 2-(3-aminophenyl)acetate.
Molecular Properties
| Compound Name | cycloheptyl 2-(3-aminophenyl)acetate |
| PubChem CID | 62499374 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | cycloheptyl 2-(3-aminophenyl)acetate |
| SMILES | Nc1cccc(CC(=O)OC2CCCCCC2)c1 |
| InChI | InChI=1S/C15H21NO2/c16-13-7-5-6-12(10-13)11-15(17)18-14-8-3-1-2-4-9-14/h5-7,10,14H,1-4,8-9,11,16H2 |
| InChIKey | UOKABIKVAMGLIZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze cycloheptyl 2-(3-aminophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptyl 2-(3-aminophenyl)acetate?
The IUPAC name of cycloheptyl 2-(3-aminophenyl)acetate (CID 62499374) is cycloheptyl 2-(3-aminophenyl)acetate.
What is the SMILES notation for cycloheptyl 2-(3-aminophenyl)acetate?
The canonical SMILES for cycloheptyl 2-(3-aminophenyl)acetate is Nc1cccc(CC(=O)OC2CCCCCC2)c1.
What is the InChIKey of cycloheptyl 2-(3-aminophenyl)acetate?
The InChIKey is UOKABIKVAMGLIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c16-13-7-5-6-12(10-13)11-15(17)18-14-8-3-1-2-4-9-14/h5-7,10,14H,1-4,8-9,11,16H2.
What are the key properties of cycloheptyl 2-(3-aminophenyl)acetate?
cycloheptyl 2-(3-aminophenyl)acetate has a molecular weight of 247.34 g/mol, XLogP of 3.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptyl 2-(3-aminophenyl)acetate is sourced from PubChem (CID 62499374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).