C14H19ClN2OS — CID 62523628
N-(3-chloro-4-methoxyphenyl)-4,4-diethyl-5H-1,3-thiazol-2-amine (PubChem CID 62523628) has the molecular formula C14H19ClN2OS and a molecular weight of 298.84 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-4,4-diethyl-5H-1,3-thiazol-2-amine.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-4,4-diethyl-5H-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62523628 |
| Molecular Formula | C14H19ClN2OS |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-4,4-diethyl-5H-1,3-thiazol-2-amine |
| SMILES | CCC1(CC)CSC(Nc2ccc(OC)c(Cl)c2)=N1 |
| InChI | InChI=1S/C14H19ClN2OS/c1-4-14(5-2)9-19-13(17-14)16-10-6-7-12(18-3)11(15)8-10/h6-8H,4-5,9H2,1-3H3,(H,16,17) |
| InChIKey | WQNIQJSNRWVJKA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |