C15H23NO2S2 — CID 62526504
N-[1-(hydroxymethyl)-3-methylcyclohexyl]-2-(thiophen-2-ylmethylsulfanyl)acetamide (PubChem CID 62526504) has the molecular formula C15H23NO2S2 and a molecular weight of 313.49 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)-3-methylcyclohexyl]-2-(thiophen-2-ylmethylsulfanyl)acetamide.
| Compound Name | N-[1-(hydroxymethyl)-3-methylcyclohexyl]-2-(thiophen-2-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 62526504 |
| Molecular Formula | C15H23NO2S2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-[1-(hydroxymethyl)-3-methylcyclohexyl]-2-(thiophen-2-ylmethylsulfanyl)acetamide |
| SMILES | CC1CCCC(CO)(NC(=O)CSCc2cccs2)C1 |
| InChI | InChI=1S/C15H23NO2S2/c1-12-4-2-6-15(8-12,11-17)16-14(18)10-19-9-13-5-3-7-20-13/h3,5,7,12,17H,2,4,6,8-11H2,1H3,(H,16,18) |
| InChIKey | SQHFJDQTSBWFQS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |