C13H22N4O2 — CID 62527236
4-amino-N-[1-(hydroxymethyl)-4-methylcyclohexyl]-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 62527236) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-amino-N-[1-(hydroxymethyl)-4-methylcyclohexyl]-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-N-[1-(hydroxymethyl)-4-methylcyclohexyl]-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 62527236 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 4-amino-N-[1-(hydroxymethyl)-4-methylcyclohexyl]-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)NC2(CO)CCC(C)CC2)c1N |
| InChI | InChI=1S/C13H22N4O2/c1-8-3-5-13(7-18,6-4-8)15-12(19)11-10(14)9(2)16-17-11/h8,18H,3-7,14H2,1-2H3,(H,15,19)(H,16,17) |
| InChIKey | ITXDEUBEVXUJBP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |