C18H16N8O4S — CID 6253036
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-5-thiophen-2-yltriazole-4-carboxamide (PubChem CID 6253036) has the molecular formula C18H16N8O4S and a molecular weight of 440.45 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-5-thiophen-2-yltriazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-5-thiophen-2-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 6253036 |
| Molecular Formula | C18H16N8O4S |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-5-thiophen-2-yltriazole-4-carboxamide |
| SMILES | COc1ccc(/C=N\NC(=O)c2nnn(-c3nonc3N)c2-c2cccs2)c(OC)c1 |
| InChI | InChI=1S/C18H16N8O4S/c1-28-11-6-5-10(12(8-11)29-2)9-20-22-18(27)14-15(13-4-3-7-31-13)26(25-21-14)17-16(19)23-30-24-17/h3-9H,1-2H3,(H2,19,23)(H,22,27)/b20-9- |
| InChIKey | MIXUSGWWLKVRAC-UKWGHVSLSA-N |
| XLogP | 1.74 |
| TPSA | 155.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|