C18H14N8O5S — CID 6868629
2-[2-[(E)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-thiophen-2-yltriazole-4-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 6868629) has the molecular formula C18H14N8O5S and a molecular weight of 454.43 g/mol. Its IUPAC name is 2-[2-[(E)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-thiophen-2-yltriazole-4-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(E)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-thiophen-2-yltriazole-4-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 6868629 |
| Molecular Formula | C18H14N8O5S |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 2-[2-[(E)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-thiophen-2-yltriazole-4-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | Nc1nonc1-n1nnc(C(=O)N/N=C/c2ccccc2OCC(=O)O)c1-c1cccs1 |
| InChI | InChI=1S/C18H14N8O5S/c19-16-17(24-31-23-16)26-15(12-6-3-7-32-12)14(21-25-26)18(29)22-20-8-10-4-1-2-5-11(10)30-9-13(27)28/h1-8H,9H2,(H2,19,23)(H,22,29)(H,27,28)/b20-8+ |
| InChIKey | BHWIEWGUMFWOIT-DNTJNYDQSA-N |
| XLogP | 1.19 |
| TPSA | 183.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|