C14H18F2N2O3 — CID 62531973
[1-(2,3-difluoro-6-nitroanilino)-3-methylcyclohexyl]methanol (PubChem CID 62531973) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.31 g/mol. Its IUPAC name is [1-(2,3-difluoro-6-nitroanilino)-3-methylcyclohexyl]methanol.
| Compound Name | [1-(2,3-difluoro-6-nitroanilino)-3-methylcyclohexyl]methanol |
|---|---|
| PubChem CID | 62531973 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | [1-(2,3-difluoro-6-nitroanilino)-3-methylcyclohexyl]methanol |
| SMILES | CC1CCCC(CO)(Nc2c([N+](=O)[O-])ccc(F)c2F)C1 |
| InChI | InChI=1S/C14H18F2N2O3/c1-9-3-2-6-14(7-9,8-19)17-13-11(18(20)21)5-4-10(15)12(13)16/h4-5,9,17,19H,2-3,6-8H2,1H3 |
| InChIKey | JEOBUUDFJWPBEN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|