C11H12F2N4 — CID 62532331
3,4-difluoro-2-N-(2-imidazol-1-ylethyl)benzene-1,2-diamine (PubChem CID 62532331) has the molecular formula C11H12F2N4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 3,4-difluoro-2-N-(2-imidazol-1-ylethyl)benzene-1,2-diamine.
| Compound Name | 3,4-difluoro-2-N-(2-imidazol-1-ylethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 62532331 |
| Molecular Formula | C11H12F2N4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3,4-difluoro-2-N-(2-imidazol-1-ylethyl)benzene-1,2-diamine |
| SMILES | Nc1ccc(F)c(F)c1NCCn1ccnc1 |
| InChI | InChI=1S/C11H12F2N4/c12-8-1-2-9(14)11(10(8)13)16-4-6-17-5-3-15-7-17/h1-3,5,7,16H,4,6,14H2 |
| InChIKey | XZZSVPSSGZUVQX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|