C31H34N2O6 — CID 6253266
(E)-[1-[3-(dimethylazaniumyl)propyl]-2-(4-hydroxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-[4-[(2-methylphenyl)methoxy]phenyl]methanolate (PubChem CID 6253266) has the molecular formula C31H34N2O6 and a molecular weight of 530.62 g/mol. Its IUPAC name is (E)-[1-[3-(dimethylazaniumyl)propyl]-2-(4-hydroxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-[4-[(2-methylphenyl)methoxy]phenyl]methanolate.
| Compound Name | (E)-[1-[3-(dimethylazaniumyl)propyl]-2-(4-hydroxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-[4-[(2-methylphenyl)methoxy]phenyl]methanolate |
|---|---|
| PubChem CID | 6253266 |
| Molecular Formula | C31H34N2O6 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | (E)-[1-[3-(dimethylazaniumyl)propyl]-2-(4-hydroxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-[4-[(2-methylphenyl)methoxy]phenyl]methanolate |
| SMILES | COc1cc(C2/C(=C(\[O-])c3ccc(OCc4ccccc4C)cc3)C(=O)C(=O)N2CCC[NH+](C)C)ccc1O |
| InChI | InChI=1S/C31H34N2O6/c1-20-8-5-6-9-23(20)19-39-24-13-10-21(11-14-24)29(35)27-28(22-12-15-25(34)26(18-22)38-4)33(31(37)30(27)36)17-7-16-32(2)3/h5-6,8-15,18,28,34-35H,7,16-17,19H2,1-4H3/b29-27+ |
| InChIKey | CAFIJGLDCUVXST-ORIPQNMZSA-N |
| XLogP | 2.05 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|