C15H23NO5 — CID 62541892
methyl 2-(2,4-dimethoxyphenyl)-2-(2-methoxyethylamino)propanoate (PubChem CID 62541892) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is methyl 2-(2,4-dimethoxyphenyl)-2-(2-methoxyethylamino)propanoate.
| Compound Name | methyl 2-(2,4-dimethoxyphenyl)-2-(2-methoxyethylamino)propanoate |
|---|---|
| PubChem CID | 62541892 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | methyl 2-(2,4-dimethoxyphenyl)-2-(2-methoxyethylamino)propanoate |
| SMILES | COCCNC(C)(C(=O)OC)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C15H23NO5/c1-15(14(17)21-5,16-8-9-18-2)12-7-6-11(19-3)10-13(12)20-4/h6-7,10,16H,8-9H2,1-5H3 |
| InChIKey | BZXASWZBIJYUDC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|