C14H15ClN2S — CID 62542301
4-(4-chlorophenyl)-5-methyl-2-pyrrolidin-2-yl-1,3-thiazole (PubChem CID 62542301) has the molecular formula C14H15ClN2S and a molecular weight of 278.81 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-methyl-2-pyrrolidin-2-yl-1,3-thiazole.
| Compound Name | 4-(4-chlorophenyl)-5-methyl-2-pyrrolidin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 62542301 |
| Molecular Formula | C14H15ClN2S |
| Molecular Weight | 278.81 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 4-(4-chlorophenyl)-5-methyl-2-pyrrolidin-2-yl-1,3-thiazole |
| SMILES | Cc1sc(C2CCCN2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H15ClN2S/c1-9-13(10-4-6-11(15)7-5-10)17-14(18-9)12-3-2-8-16-12/h4-7,12,16H,2-3,8H2,1H3 |
| InChIKey | FJZDYKHSYYPRDX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.81 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |