C15H16N2S — CID 62541233
2-pyrrolidin-2-yl-4,5-dihydrobenzo[e][1,3]benzothiazole (PubChem CID 62541233) has the molecular formula C15H16N2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-4,5-dihydrobenzo[e][1,3]benzothiazole.
| Compound Name | 2-pyrrolidin-2-yl-4,5-dihydrobenzo[e][1,3]benzothiazole |
|---|---|
| PubChem CID | 62541233 |
| Molecular Formula | C15H16N2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-pyrrolidin-2-yl-4,5-dihydrobenzo[e][1,3]benzothiazole |
| SMILES | c1ccc2c(c1)CCc1sc(C3CCCN3)nc1-2 |
| InChI | InChI=1S/C15H16N2S/c1-2-5-11-10(4-1)7-8-13-14(11)17-15(18-13)12-6-3-9-16-12/h1-2,4-5,12,16H,3,6-9H2 |
| InChIKey | AOPRTEHSONJULV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |