C17H20N2OS — CID 81140549
4,4-dimethyl-2-piperidin-2-ylchromeno[4,3-d][1,3]thiazole (PubChem CID 81140549) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is 4,4-dimethyl-2-piperidin-2-ylchromeno[4,3-d][1,3]thiazole.
| Compound Name | 4,4-dimethyl-2-piperidin-2-ylchromeno[4,3-d][1,3]thiazole |
|---|---|
| PubChem CID | 81140549 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4,4-dimethyl-2-piperidin-2-ylchromeno[4,3-d][1,3]thiazole |
| SMILES | CC1(C)Oc2ccccc2-c2nc(C3CCCCN3)sc21 |
| InChI | InChI=1S/C17H20N2OS/c1-17(2)15-14(11-7-3-4-9-13(11)20-17)19-16(21-15)12-8-5-6-10-18-12/h3-4,7,9,12,18H,5-6,8,10H2,1-2H3 |
| InChIKey | ULBAYCSPQQCSJW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |