C14H16N2OS — CID 113315254
2-piperidin-2-yl-4,5-dihydrofuro[3,2-e][1,3]benzothiazole (PubChem CID 113315254) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-piperidin-2-yl-4,5-dihydrofuro[3,2-e][1,3]benzothiazole.
| Compound Name | 2-piperidin-2-yl-4,5-dihydrofuro[3,2-e][1,3]benzothiazole |
|---|---|
| PubChem CID | 113315254 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-piperidin-2-yl-4,5-dihydrofuro[3,2-e][1,3]benzothiazole |
| SMILES | c1cc2c(o1)CCc1sc(C3CCCCN3)nc1-2 |
| InChI | InChI=1S/C14H16N2OS/c1-2-7-15-10(3-1)14-16-13-9-6-8-17-11(9)4-5-12(13)18-14/h6,8,10,15H,1-5,7H2 |
| InChIKey | JLELAPCFQUMKIF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |