C12H13ClN2S — CID 79528887
6-chloro-2-piperidin-2-yl-1,3-benzothiazole (PubChem CID 79528887) has the molecular formula C12H13ClN2S and a molecular weight of 252.77 g/mol. Its IUPAC name is 6-chloro-2-piperidin-2-yl-1,3-benzothiazole.
| Compound Name | 6-chloro-2-piperidin-2-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 79528887 |
| Molecular Formula | C12H13ClN2S |
| Molecular Weight | 252.77 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 6-chloro-2-piperidin-2-yl-1,3-benzothiazole |
| SMILES | Clc1ccc2nc(C3CCCCN3)sc2c1 |
| InChI | InChI=1S/C12H13ClN2S/c13-8-4-5-9-11(7-8)16-12(15-9)10-3-1-2-6-14-10/h4-5,7,10,14H,1-3,6H2 |
| InChIKey | YILPDLXPPYXGMX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.77 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |