C13H26N4O3S — CID 62546511
2-[3-(methylamino)piperidin-1-yl]-1-(4-methylsulfonylpiperazin-1-yl)ethanone (PubChem CID 62546511) has the molecular formula C13H26N4O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is 2-[3-(methylamino)piperidin-1-yl]-1-(4-methylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 2-[3-(methylamino)piperidin-1-yl]-1-(4-methylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 62546511 |
| Molecular Formula | C13H26N4O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-[3-(methylamino)piperidin-1-yl]-1-(4-methylsulfonylpiperazin-1-yl)ethanone |
| SMILES | CNC1CCCN(CC(=O)N2CCN(S(C)(=O)=O)CC2)C1 |
| InChI | InChI=1S/C13H26N4O3S/c1-14-12-4-3-5-15(10-12)11-13(18)16-6-8-17(9-7-16)21(2,19)20/h12,14H,3-11H2,1-2H3 |
| InChIKey | ACLTWXDDKSWCJB-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |