C11H17BrN2O2S2 — CID 62560431
N-[(4-bromothiophen-2-yl)methyl]-2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine (PubChem CID 62560431) has the molecular formula C11H17BrN2O2S2 and a molecular weight of 353.31 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine |
|---|---|
| PubChem CID | 62560431 |
| Molecular Formula | C11H17BrN2O2S2 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine |
| SMILES | O=S1(=O)CCN(CCNCc2cc(Br)cs2)CC1 |
| InChI | InChI=1S/C11H17BrN2O2S2/c12-10-7-11(17-9-10)8-13-1-2-14-3-5-18(15,16)6-4-14/h7,9,13H,1-6,8H2 |
| InChIKey | AABZNAMYLJFYMV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|