C14H24BrN3S — CID 55217013
N-[(4-bromothiophen-2-yl)methyl]-2-(3-ethyl-4-methylpiperazin-1-yl)ethanamine (PubChem CID 55217013) has the molecular formula C14H24BrN3S and a molecular weight of 346.34 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(3-ethyl-4-methylpiperazin-1-yl)ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(3-ethyl-4-methylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 55217013 |
| Molecular Formula | C14H24BrN3S |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(3-ethyl-4-methylpiperazin-1-yl)ethanamine |
| SMILES | CCC1CN(CCNCc2cc(Br)cs2)CCN1C |
| InChI | InChI=1S/C14H24BrN3S/c1-3-13-10-18(7-6-17(13)2)5-4-16-9-14-8-12(15)11-19-14/h8,11,13,16H,3-7,9-10H2,1-2H3 |
| InChIKey | PACPLMCOZHPGAQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|