C17H29N3S — CID 62561259
N-[2-(4-cyclopentylpiperazin-1-yl)ethyl]-1-thiophen-2-ylethanamine (PubChem CID 62561259) has the molecular formula C17H29N3S and a molecular weight of 307.51 g/mol. Its IUPAC name is N-[2-(4-cyclopentylpiperazin-1-yl)ethyl]-1-thiophen-2-ylethanamine.
| Compound Name | N-[2-(4-cyclopentylpiperazin-1-yl)ethyl]-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 62561259 |
| Molecular Formula | C17H29N3S |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | N-[2-(4-cyclopentylpiperazin-1-yl)ethyl]-1-thiophen-2-ylethanamine |
| SMILES | CC(NCCN1CCN(C2CCCC2)CC1)c1cccs1 |
| InChI | InChI=1S/C17H29N3S/c1-15(17-7-4-14-21-17)18-8-9-19-10-12-20(13-11-19)16-5-2-3-6-16/h4,7,14-16,18H,2-3,5-6,8-13H2,1H3 |
| InChIKey | BDFPGUGJMUACMP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |