C14H21F3N2S — CID 62573499
1-thiophen-2-yl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethanamine (PubChem CID 62573499) has the molecular formula C14H21F3N2S and a molecular weight of 306.40 g/mol. Its IUPAC name is 1-thiophen-2-yl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethanamine.
| Compound Name | 1-thiophen-2-yl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethanamine |
|---|---|
| PubChem CID | 62573499 |
| Molecular Formula | C14H21F3N2S |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-thiophen-2-yl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethanamine |
| SMILES | CC(NCCN1CCCC(C(F)(F)F)C1)c1cccs1 |
| InChI | InChI=1S/C14H21F3N2S/c1-11(13-5-3-9-20-13)18-6-8-19-7-2-4-12(10-19)14(15,16)17/h3,5,9,11-12,18H,2,4,6-8,10H2,1H3 |
| InChIKey | IHQNCQPARLCJQC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |