C12H22BrN3O — CID 62566583
N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]-3-ethoxypropan-1-amine (PubChem CID 62566583) has the molecular formula C12H22BrN3O and a molecular weight of 304.23 g/mol. Its IUPAC name is N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]-3-ethoxypropan-1-amine.
| Compound Name | N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]-3-ethoxypropan-1-amine |
|---|---|
| PubChem CID | 62566583 |
| Molecular Formula | C12H22BrN3O |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]-3-ethoxypropan-1-amine |
| SMILES | CCOCCCNCCn1nc(C)c(Br)c1C |
| InChI | InChI=1S/C12H22BrN3O/c1-4-17-9-5-6-14-7-8-16-11(3)12(13)10(2)15-16/h14H,4-9H2,1-3H3 |
| InChIKey | QJXCTEONOIFDTB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|