C15H15F2NS — CID 62577630
N-[2-(2,5-difluorophenyl)sulfanylethyl]-2-methylaniline (PubChem CID 62577630) has the molecular formula C15H15F2NS and a molecular weight of 279.36 g/mol. Its IUPAC name is N-[2-(2,5-difluorophenyl)sulfanylethyl]-2-methylaniline.
| Compound Name | N-[2-(2,5-difluorophenyl)sulfanylethyl]-2-methylaniline |
|---|---|
| PubChem CID | 62577630 |
| Molecular Formula | C15H15F2NS |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | N-[2-(2,5-difluorophenyl)sulfanylethyl]-2-methylaniline |
| SMILES | Cc1ccccc1NCCSc1cc(F)ccc1F |
| InChI | InChI=1S/C15H15F2NS/c1-11-4-2-3-5-14(11)18-8-9-19-15-10-12(16)6-7-13(15)17/h2-7,10,18H,8-9H2,1H3 |
| InChIKey | WPZJEALYWQBBAY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|