C13H21ClN2S — CID 62581145
N-[[1-[(5-chlorothiophen-2-yl)methyl]piperidin-3-yl]methyl]ethanamine (PubChem CID 62581145) has the molecular formula C13H21ClN2S and a molecular weight of 272.84 g/mol. Its IUPAC name is N-[[1-[(5-chlorothiophen-2-yl)methyl]piperidin-3-yl]methyl]ethanamine.
| Compound Name | N-[[1-[(5-chlorothiophen-2-yl)methyl]piperidin-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 62581145 |
| Molecular Formula | C13H21ClN2S |
| Molecular Weight | 272.84 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N-[[1-[(5-chlorothiophen-2-yl)methyl]piperidin-3-yl]methyl]ethanamine |
| SMILES | CCNCC1CCCN(Cc2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C13H21ClN2S/c1-2-15-8-11-4-3-7-16(9-11)10-12-5-6-13(14)17-12/h5-6,11,15H,2-4,7-10H2,1H3 |
| InChIKey | FDWIGCGZADWSDG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.84 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |