C11H12FN3OS — CID 62582083
3-fluoro-N-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl]aniline (PubChem CID 62582083) has the molecular formula C11H12FN3OS and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-fluoro-N-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl]aniline.
| Compound Name | 3-fluoro-N-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl]aniline |
|---|---|
| PubChem CID | 62582083 |
| Molecular Formula | C11H12FN3OS |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 3-fluoro-N-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl]aniline |
| SMILES | Cc1nnc(SCCNc2cccc(F)c2)o1 |
| InChI | InChI=1S/C11H12FN3OS/c1-8-14-15-11(16-8)17-6-5-13-10-4-2-3-9(12)7-10/h2-4,7,13H,5-6H2,1H3 |
| InChIKey | FUAWJSXBQLPZRI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|