C14H14N4O2S — CID 62255609
N-(3-cyanophenyl)-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]butanamide (PubChem CID 62255609) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is N-(3-cyanophenyl)-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]butanamide.
| Compound Name | N-(3-cyanophenyl)-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 62255609 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-(3-cyanophenyl)-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]butanamide |
| SMILES | Cc1nnc(SCCCC(=O)Nc2cccc(C#N)c2)o1 |
| InChI | InChI=1S/C14H14N4O2S/c1-10-17-18-14(20-10)21-7-3-6-13(19)16-12-5-2-4-11(8-12)9-15/h2,4-5,8H,3,6-7H2,1H3,(H,16,19) |
| InChIKey | ZOXHUSIQYFLRFD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|