C21H34O3S2 — CID 625946
8-hydroxy-16-pentyl-15-oxa-1,5-dithiaspiro[5.13]nonadec-10-yn-14-one (PubChem CID 625946) has the molecular formula C21H34O3S2 and a molecular weight of 398.63 g/mol. Its IUPAC name is 8-hydroxy-16-pentyl-15-oxa-1,5-dithiaspiro[5.13]nonadec-10-yn-14-one.
| Compound Name | 8-hydroxy-16-pentyl-15-oxa-1,5-dithiaspiro[5.13]nonadec-10-yn-14-one |
|---|---|
| PubChem CID | 625946 |
| Molecular Formula | C21H34O3S2 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 8-hydroxy-16-pentyl-15-oxa-1,5-dithiaspiro[5.13]nonadec-10-yn-14-one |
| SMILES | CCCCCC1CCCC2(CC(O)CC#CCCC(=O)O1)SCCCS2 |
| InChI | InChI=1S/C21H34O3S2/c1-2-3-5-11-19-12-8-14-21(25-15-9-16-26-21)17-18(22)10-6-4-7-13-20(23)24-19/h18-19,22H,2-3,5,7-17H2,1H3 |
| InChIKey | VKWIFDFIOBRTQF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|