C14H14BrNO — CID 626026
1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrole-3-carbaldehyde (PubChem CID 626026) has the molecular formula C14H14BrNO and a molecular weight of 292.18 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrole-3-carbaldehyde.
| Compound Name | 1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 626026 |
| Molecular Formula | C14H14BrNO |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrole-3-carbaldehyde |
| SMILES | Cc1cc(-n2c(C)cc(C=O)c2C)ccc1Br |
| InChI | InChI=1S/C14H14BrNO/c1-9-6-13(4-5-14(9)15)16-10(2)7-12(8-17)11(16)3/h4-8H,1-3H3 |
| InChIKey | IPDHOFOKIBKZRN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|