C24H20FN3O3 — CID 6260919
N-[(E)-1-(4-fluorophenyl)-3-[2-[1-(2-hydroxyphenyl)ethenyl]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 6260919) has the molecular formula C24H20FN3O3 and a molecular weight of 417.44 g/mol. Its IUPAC name is N-[(E)-1-(4-fluorophenyl)-3-[2-[1-(2-hydroxyphenyl)ethenyl]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(4-fluorophenyl)-3-[2-[1-(2-hydroxyphenyl)ethenyl]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 6260919 |
| Molecular Formula | C24H20FN3O3 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[(E)-1-(4-fluorophenyl)-3-[2-[1-(2-hydroxyphenyl)ethenyl]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | C=C(NNC(=O)/C(=C\c1ccc(F)cc1)NC(=O)c1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C24H20FN3O3/c1-16(20-9-5-6-10-22(20)29)27-28-24(31)21(15-17-11-13-19(25)14-12-17)26-23(30)18-7-3-2-4-8-18/h2-15,27,29H,1H2,(H,26,30)(H,28,31)/b21-15+ |
| InChIKey | NJOBSZVKOHTFKR-RCCKNPSSSA-N |
| XLogP | 3.59 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|