C11H23NO2S — CID 62625148
4,4-dimethyl-1-(1-oxo-1,4-thiazinan-4-yl)pentan-3-ol (PubChem CID 62625148) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is 4,4-dimethyl-1-(1-oxo-1,4-thiazinan-4-yl)pentan-3-ol.
| Compound Name | 4,4-dimethyl-1-(1-oxo-1,4-thiazinan-4-yl)pentan-3-ol |
|---|---|
| PubChem CID | 62625148 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 4,4-dimethyl-1-(1-oxo-1,4-thiazinan-4-yl)pentan-3-ol |
| SMILES | CC(C)(C)C(O)CCN1CCS(=O)CC1 |
| InChI | InChI=1S/C11H23NO2S/c1-11(2,3)10(13)4-5-12-6-8-15(14)9-7-12/h10,13H,4-9H2,1-3H3 |
| InChIKey | KYUNPNAMQWVQCN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |