C18H16ClN3O2 — CID 6265225
N-(3-chlorophenyl)-N'-[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]oxamide (PubChem CID 6265225) has the molecular formula C18H16ClN3O2 and a molecular weight of 341.80 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N'-[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]oxamide.
| Compound Name | N-(3-chlorophenyl)-N'-[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]oxamide |
|---|---|
| PubChem CID | 6265225 |
| Molecular Formula | C18H16ClN3O2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-(3-chlorophenyl)-N'-[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]oxamide |
| SMILES | CC(/C=C/c1ccccc1)=N/NC(=O)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H16ClN3O2/c1-13(10-11-14-6-3-2-4-7-14)21-22-18(24)17(23)20-16-9-5-8-15(19)12-16/h2-12H,1H3,(H,20,23)(H,22,24)/b11-10+,21-13- |
| InChIKey | XEKWKWVYXICMMA-SNTPLNSLSA-N |
| XLogP | 3.48 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|