C15H20N2O4 — CID 62657041
1-[2-(2-pyridin-2-ylethoxy)acetyl]piperidine-4-carboxylic acid (PubChem CID 62657041) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 1-[2-(2-pyridin-2-ylethoxy)acetyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-(2-pyridin-2-ylethoxy)acetyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 62657041 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-[2-(2-pyridin-2-ylethoxy)acetyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)COCCc2ccccn2)CC1 |
| InChI | InChI=1S/C15H20N2O4/c18-14(17-8-4-12(5-9-17)15(19)20)11-21-10-6-13-3-1-2-7-16-13/h1-3,7,12H,4-6,8-11H2,(H,19,20) |
| InChIKey | WEMMDZZMHGFOSV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|