C14H17ClN2O3S — CID 62659336
1-[2-(2-amino-4-chlorophenyl)sulfanylacetyl]piperidine-4-carboxylic acid (PubChem CID 62659336) has the molecular formula C14H17ClN2O3S and a molecular weight of 328.82 g/mol. Its IUPAC name is 1-[2-(2-amino-4-chlorophenyl)sulfanylacetyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-(2-amino-4-chlorophenyl)sulfanylacetyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 62659336 |
| Molecular Formula | C14H17ClN2O3S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 1-[2-(2-amino-4-chlorophenyl)sulfanylacetyl]piperidine-4-carboxylic acid |
| SMILES | Nc1cc(Cl)ccc1SCC(=O)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C14H17ClN2O3S/c15-10-1-2-12(11(16)7-10)21-8-13(18)17-5-3-9(4-6-17)14(19)20/h1-2,7,9H,3-6,8,16H2,(H,19,20) |
| InChIKey | MGHQXDFQUBKWNV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|