C13H13BrFN3OS — CID 62661675
N-[(5-bromothiophen-3-yl)methyl]-3-fluoro-2-hydrazinyl-N-methylbenzamide (PubChem CID 62661675) has the molecular formula C13H13BrFN3OS and a molecular weight of 358.24 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-3-fluoro-2-hydrazinyl-N-methylbenzamide.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-3-fluoro-2-hydrazinyl-N-methylbenzamide |
|---|---|
| PubChem CID | 62661675 |
| Molecular Formula | C13H13BrFN3OS |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-3-fluoro-2-hydrazinyl-N-methylbenzamide |
| SMILES | CN(Cc1csc(Br)c1)C(=O)c1cccc(F)c1NN |
| InChI | InChI=1S/C13H13BrFN3OS/c1-18(6-8-5-11(14)20-7-8)13(19)9-3-2-4-10(15)12(9)17-16/h2-5,7,17H,6,16H2,1H3 |
| InChIKey | CJISDUFYRLGIQH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|