4-(2,2-dimethylbutanoylamino)-4-methylpentanoic acid

C12H23NO3 — CID 62677448

IUPAC4-(2,2-dimethylbutanoylamino)-4-methylpentanoic acid
SMILESCCC(C)(C)C(=O)NC(C)(C)CCC(=O)O
InChIInChI=1S/C12H23NO3/c1-6-11(2,3)10(16)13-12(4,5)8-7-9(14)15/h6-8H2,1-5H3,(H,13,16)(H,14,15)
InChIKeyDTZMKBGZKZNYNC-UHFFFAOYSA-N
MW229.32 g/mol
LogP2.18
Rot. Bonds6

About 4-(2,2-dimethylbutanoylamino)-4-methylpentanoic acid

4-(2,2-dimethylbutanoylamino)-4-methylpentanoic acid (PubChem CID 62677448) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 4-(2,2-dimethylbutanoylamino)-4-methylpentanoic acid.

Molecular Properties

Compound Name4-(2,2-dimethylbutanoylamino)-4-methylpentanoic acid
PubChem CID62677448
Molecular FormulaC12H23NO3
Molecular Weight229.32 g/mol
Exact Mass229.17
IUPAC Name4-(2,2-dimethylbutanoylamino)-4-methylpentanoic acid
SMILESCCC(C)(C)C(=O)NC(C)(C)CCC(=O)O
InChIInChI=1S/C12H23NO3/c1-6-11(2,3)10(16)13-12(4,5)8-7-9(14)15/h6-8H2,1-5H3,(H,13,16)(H,14,15)
InChIKeyDTZMKBGZKZNYNC-UHFFFAOYSA-N
XLogP2.18
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.32
LogP ≤ 52.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-(2,2-dimethylbutanoylamino)-4-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,2-dimethylbutanoylamino)-4-methylpentanoic acid?
The IUPAC name of 4-(2,2-dimethylbutanoylamino)-4-methylpentanoic acid (CID 62677448) is 4-(2,2-dimethylbutanoylamino)-4-methylpentanoic acid.
What is the SMILES notation for 4-(2,2-dimethylbutanoylamino)-4-methylpentanoic acid?
The canonical SMILES for 4-(2,2-dimethylbutanoylamino)-4-methylpentanoic acid is CCC(C)(C)C(=O)NC(C)(C)CCC(=O)O.
What is the InChIKey of 4-(2,2-dimethylbutanoylamino)-4-methylpentanoic acid?
The InChIKey is DTZMKBGZKZNYNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c1-6-11(2,3)10(16)13-12(4,5)8-7-9(14)15/h6-8H2,1-5H3,(H,13,16)(H,14,15).
What are the key properties of 4-(2,2-dimethylbutanoylamino)-4-methylpentanoic acid?
4-(2,2-dimethylbutanoylamino)-4-methylpentanoic acid has a molecular weight of 229.32 g/mol, XLogP of 2.18, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethylbutanoylamino)-4-methylpentanoic acid is sourced from PubChem (CID 62677448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).