About N-(2-aminoethyl)-N,3-dimethylbut-2-enamide
N-(2-aminoethyl)-N,3-dimethylbut-2-enamide (PubChem CID 62681125) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is N-(2-aminoethyl)-N,3-dimethylbut-2-enamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-N,3-dimethylbut-2-enamide |
| PubChem CID | 62681125 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | N-(2-aminoethyl)-N,3-dimethylbut-2-enamide |
| SMILES | CC(C)=CC(=O)N(C)CCN |
| InChI | InChI=1S/C8H16N2O/c1-7(2)6-8(11)10(3)5-4-9/h6H,4-5,9H2,1-3H3 |
| InChIKey | YCECEVSYQSBPFX-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-N,3-dimethylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-N,3-dimethylbut-2-enamide?
The IUPAC name of N-(2-aminoethyl)-N,3-dimethylbut-2-enamide (CID 62681125) is N-(2-aminoethyl)-N,3-dimethylbut-2-enamide.
What is the SMILES notation for N-(2-aminoethyl)-N,3-dimethylbut-2-enamide?
The canonical SMILES for N-(2-aminoethyl)-N,3-dimethylbut-2-enamide is CC(C)=CC(=O)N(C)CCN.
What is the InChIKey of N-(2-aminoethyl)-N,3-dimethylbut-2-enamide?
The InChIKey is YCECEVSYQSBPFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-7(2)6-8(11)10(3)5-4-9/h6H,4-5,9H2,1-3H3.
What are the key properties of N-(2-aminoethyl)-N,3-dimethylbut-2-enamide?
N-(2-aminoethyl)-N,3-dimethylbut-2-enamide has a molecular weight of 156.23 g/mol, XLogP of 0.37, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-N,3-dimethylbut-2-enamide is sourced from PubChem (CID 62681125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).