C9H18N2O2 — CID 170240905
N-(2-aminoethyl)-N,3-dimethyl-4-oxopentanamide (PubChem CID 170240905) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is N-(2-aminoethyl)-N,3-dimethyl-4-oxopentanamide.
| Compound Name | N-(2-aminoethyl)-N,3-dimethyl-4-oxopentanamide |
|---|---|
| PubChem CID | 170240905 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | N-(2-aminoethyl)-N,3-dimethyl-4-oxopentanamide |
| SMILES | CC(=O)C(C)CC(=O)N(C)CCN |
| InChI | InChI=1S/C9H18N2O2/c1-7(8(2)12)6-9(13)11(3)5-4-10/h7H,4-6,10H2,1-3H3 |
| InChIKey | FRVIGIRVNHJJDC-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |